Merge pull request #138 from rvflash/master
godog command is on error with go modules and sub-packages
Этот коммит содержится в:
коммит
138e107f34
14 изменённых файлов: 103 добавлений и 117 удалений
|
@ -241,6 +241,8 @@ func makeImportValid(r rune) rune {
|
|||
return r
|
||||
}
|
||||
|
||||
type void struct{}
|
||||
|
||||
func uniqStringList(strs []string) (unique []string) {
|
||||
uniq := make(map[string]void, len(strs))
|
||||
for _, s := range strs {
|
||||
|
|
102
builder_go110.go
102
builder_go110.go
|
@ -4,6 +4,7 @@ package godog
|
|||
|
||||
import (
|
||||
"bytes"
|
||||
"encoding/json"
|
||||
"fmt"
|
||||
"go/build"
|
||||
"go/parser"
|
||||
|
@ -19,16 +20,15 @@ import (
|
|||
"unicode"
|
||||
)
|
||||
|
||||
var tooldir = findToolDir()
|
||||
var compiler = filepath.Join(tooldir, "compile")
|
||||
var linker = filepath.Join(tooldir, "link")
|
||||
var gopaths = filepath.SplitList(build.Default.GOPATH)
|
||||
var goarch = build.Default.GOARCH
|
||||
var goroot = build.Default.GOROOT
|
||||
var goos = build.Default.GOOS
|
||||
var (
|
||||
tooldir = findToolDir()
|
||||
compiler = filepath.Join(tooldir, "compile")
|
||||
linker = filepath.Join(tooldir, "link")
|
||||
gopaths = filepath.SplitList(build.Default.GOPATH)
|
||||
godogImportPath = "github.com/DATA-DOG/godog"
|
||||
|
||||
var godogImportPath = "github.com/DATA-DOG/godog"
|
||||
var runnerTemplate = template.Must(template.New("testmain").Parse(`package main
|
||||
// godep
|
||||
runnerTemplate = template.Must(template.New("testmain").Parse(`package main
|
||||
|
||||
import (
|
||||
"github.com/DATA-DOG/godog"
|
||||
|
@ -45,6 +45,7 @@ func main() {
|
|||
})
|
||||
os.Exit(status)
|
||||
}`))
|
||||
)
|
||||
|
||||
// Build creates a test package like go test command at given target path.
|
||||
// If there are no go files in tested directory, then
|
||||
|
@ -299,60 +300,78 @@ func makeImportValid(r rune) rune {
|
|||
return r
|
||||
}
|
||||
|
||||
func uniqStringList(strs []string) (unique []string) {
|
||||
uniq := make(map[string]void, len(strs))
|
||||
for _, s := range strs {
|
||||
if _, ok := uniq[s]; !ok {
|
||||
uniq[s] = void{}
|
||||
unique = append(unique, s)
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
// buildTestMain if given package is valid
|
||||
// it scans test files for contexts
|
||||
// and produces a testmain source code.
|
||||
func buildTestMain(pkg *build.Package) ([]byte, bool, error) {
|
||||
var contexts []string
|
||||
var importPath string
|
||||
name := "main"
|
||||
var (
|
||||
contexts []string
|
||||
err error
|
||||
name, importPath string
|
||||
)
|
||||
if nil != pkg {
|
||||
ctxs, err := processPackageTestFiles(
|
||||
contexts, err = processPackageTestFiles(
|
||||
pkg.TestGoFiles,
|
||||
pkg.XTestGoFiles,
|
||||
)
|
||||
if err != nil {
|
||||
return nil, false, err
|
||||
}
|
||||
contexts = ctxs
|
||||
|
||||
// for module support, query the module import path
|
||||
// @TODO: maybe there is a better way to read it
|
||||
out, err := exec.Command("go", "list", "-m").CombinedOutput()
|
||||
if err != nil {
|
||||
// is not using modules or older go version
|
||||
importPath = pkg.ImportPath
|
||||
} else {
|
||||
// otherwise read the module name from command output
|
||||
importPath = strings.TrimSpace(string(out))
|
||||
}
|
||||
importPath = parseImport(pkg.ImportPath, pkg.Root)
|
||||
name = pkg.Name
|
||||
} else {
|
||||
name = "main"
|
||||
}
|
||||
|
||||
data := struct {
|
||||
Name string
|
||||
Contexts []string
|
||||
ImportPath string
|
||||
}{name, contexts, importPath}
|
||||
|
||||
}{
|
||||
Name: name,
|
||||
Contexts: contexts,
|
||||
ImportPath: importPath,
|
||||
}
|
||||
var buf bytes.Buffer
|
||||
if err := runnerTemplate.Execute(&buf, data); err != nil {
|
||||
if err = runnerTemplate.Execute(&buf, data); err != nil {
|
||||
return nil, len(contexts) > 0, err
|
||||
}
|
||||
return buf.Bytes(), len(contexts) > 0, nil
|
||||
}
|
||||
|
||||
// parseImport parses the import path to deal with go module.
|
||||
func parseImport(rawPath, rootPath string) string {
|
||||
// with go > 1.11 and go module enabled out of the GOPATH,
|
||||
// the import path begins with an underscore and the GOPATH is unknown on build.
|
||||
if rootPath != "" {
|
||||
// go < 1.11 or it's a module inside the GOPATH
|
||||
return rawPath
|
||||
}
|
||||
// for module support, query the module import path
|
||||
cmd := exec.Command("go", "list", "-m", "-json")
|
||||
out, err := cmd.StdoutPipe()
|
||||
if err != nil {
|
||||
// Unable to read stdout
|
||||
return rawPath
|
||||
}
|
||||
if cmd.Start() != nil {
|
||||
// Does not using modules
|
||||
return rawPath
|
||||
}
|
||||
var mod struct {
|
||||
Dir string `json:"Dir"`
|
||||
Path string `json:"Path"`
|
||||
}
|
||||
if json.NewDecoder(out).Decode(&mod) != nil {
|
||||
// Unexpected result
|
||||
return rawPath
|
||||
}
|
||||
if cmd.Wait() != nil {
|
||||
return rawPath
|
||||
}
|
||||
// Concatenates the module path with the current sub-folders if needed
|
||||
return mod.Path + filepath.ToSlash(strings.TrimPrefix(strings.TrimPrefix(rawPath, "_"), mod.Dir))
|
||||
}
|
||||
|
||||
// processPackageTestFiles runs through ast of each test
|
||||
// file pack and looks for godog suite contexts to register
|
||||
// on run
|
||||
|
@ -400,16 +419,13 @@ func dependencies(pkg *build.Package, visited map[string]string, vendor bool) er
|
|||
if i := strings.LastIndex(name, "vendor/"); vendor && i == -1 {
|
||||
continue // only interested in vendor packages
|
||||
}
|
||||
|
||||
if _, ok := visited[name]; ok {
|
||||
continue
|
||||
}
|
||||
|
||||
next, err := locatePackage(name)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
visited[name] = pkg.PkgObj
|
||||
if err := dependencies(next, visited, vendor); err != nil {
|
||||
return err
|
||||
|
|
|
@ -27,7 +27,7 @@ func TestBuildTestRunnerWithoutGoFiles(t *testing.T) {
|
|||
}
|
||||
|
||||
defer func() {
|
||||
os.Chdir(pwd) // get back to current dir
|
||||
_ = os.Chdir(pwd) // get back to current dir
|
||||
}()
|
||||
|
||||
if err := Build(bin); err != nil {
|
||||
|
|
|
@ -3,19 +3,15 @@ package main
|
|||
import (
|
||||
"fmt"
|
||||
"go/build"
|
||||
"io"
|
||||
"os"
|
||||
"os/exec"
|
||||
"path/filepath"
|
||||
"regexp"
|
||||
"strconv"
|
||||
"syscall"
|
||||
|
||||
"github.com/DATA-DOG/godog"
|
||||
"github.com/DATA-DOG/godog/colors"
|
||||
)
|
||||
|
||||
var statusMatch = regexp.MustCompile("^exit status (\\d+)")
|
||||
var parsedStatus int
|
||||
|
||||
func buildAndRun() (int, error) {
|
||||
|
@ -107,20 +103,3 @@ func main() {
|
|||
}
|
||||
os.Exit(status)
|
||||
}
|
||||
|
||||
func statusOutputFilter(w io.Writer) io.Writer {
|
||||
return writerFunc(func(b []byte) (int, error) {
|
||||
if m := statusMatch.FindStringSubmatch(string(b)); len(m) > 1 {
|
||||
parsedStatus, _ = strconv.Atoi(m[1])
|
||||
// skip status stderr output
|
||||
return len(b), nil
|
||||
}
|
||||
return w.Write(b)
|
||||
})
|
||||
}
|
||||
|
||||
type writerFunc func([]byte) (int, error)
|
||||
|
||||
func (w writerFunc) Write(b []byte) (int, error) {
|
||||
return w(b)
|
||||
}
|
||||
|
|
|
@ -16,8 +16,8 @@ const (
|
|||
red
|
||||
green
|
||||
yellow
|
||||
blue
|
||||
magenta
|
||||
blue // unused
|
||||
magenta // unused
|
||||
cyan
|
||||
white
|
||||
)
|
||||
|
|
|
@ -16,7 +16,7 @@ type outputMode int
|
|||
const (
|
||||
_ outputMode = iota
|
||||
discardNonColorEscSeq
|
||||
outputNonColorEscSeq
|
||||
outputNonColorEscSeq // unused
|
||||
)
|
||||
|
||||
// Colored creates and initializes a new ansiColorWriter
|
||||
|
|
13
fmt.go
13
fmt.go
|
@ -381,9 +381,11 @@ func (f *basefmt) Summary() {
|
|||
}
|
||||
|
||||
func (s *undefinedSnippet) Args() (ret string) {
|
||||
var args []string
|
||||
var pos, idx int
|
||||
var breakLoop bool
|
||||
var (
|
||||
args []string
|
||||
pos int
|
||||
breakLoop bool
|
||||
)
|
||||
for !breakLoop {
|
||||
part := s.Expr[pos:]
|
||||
ipos := strings.Index(part, "(\\d+)")
|
||||
|
@ -392,25 +394,20 @@ func (s *undefinedSnippet) Args() (ret string) {
|
|||
case spos == -1 && ipos == -1:
|
||||
breakLoop = true
|
||||
case spos == -1:
|
||||
idx++
|
||||
pos += ipos + len("(\\d+)")
|
||||
args = append(args, reflect.Int.String())
|
||||
case ipos == -1:
|
||||
idx++
|
||||
pos += spos + len("\"([^\"]*)\"")
|
||||
args = append(args, reflect.String.String())
|
||||
case ipos < spos:
|
||||
idx++
|
||||
pos += ipos + len("(\\d+)")
|
||||
args = append(args, reflect.Int.String())
|
||||
case spos < ipos:
|
||||
idx++
|
||||
pos += spos + len("\"([^\"]*)\"")
|
||||
args = append(args, reflect.String.String())
|
||||
}
|
||||
}
|
||||
if s.argument != nil {
|
||||
idx++
|
||||
switch s.argument.(type) {
|
||||
case *gherkin.DocString:
|
||||
args = append(args, "*gherkin.DocString")
|
||||
|
|
|
@ -109,15 +109,14 @@ type cukefmt struct {
|
|||
// this is sadly not passed by gherkin nodes.
|
||||
// it restricts this formatter to run only in synchronous single
|
||||
// threaded execution. Unless running a copy of formatter for each feature
|
||||
path string
|
||||
stat stepType // last step status, before skipped
|
||||
outlineSteps int // number of current outline scenario steps
|
||||
ID string // current test id.
|
||||
results []cukeFeatureJSON // structure that represent cuke results
|
||||
curStep *cukeStep // track the current step
|
||||
curElement *cukeElement // track the current element
|
||||
curFeature *cukeFeatureJSON // track the current feature
|
||||
curOutline cukeElement // Each example show up as an outline element but the outline is parsed only once
|
||||
path string
|
||||
stat stepType // last step status, before skipped
|
||||
ID string // current test id.
|
||||
results []cukeFeatureJSON // structure that represent cuke results
|
||||
curStep *cukeStep // track the current step
|
||||
curElement *cukeElement // track the current element
|
||||
curFeature *cukeFeatureJSON // track the current feature
|
||||
curOutline cukeElement // Each example show up as an outline element but the outline is parsed only once
|
||||
// so I need to keep track of the current outline
|
||||
curRow int // current row of the example table as it is being processed.
|
||||
curExampleTags []cukeTag // temporary storage for tags associate with the current example table.
|
||||
|
|
|
@ -148,11 +148,13 @@ func (j *junitFormatter) Summary() {
|
|||
j.current().Time = timeNowFunc().Sub(j.featStarted).String()
|
||||
}
|
||||
j.suite.Time = timeNowFunc().Sub(j.started).String()
|
||||
io.WriteString(j.out, xml.Header)
|
||||
|
||||
_, err := io.WriteString(j.out, xml.Header)
|
||||
if err != nil {
|
||||
fmt.Fprintln(os.Stderr, "failed to write junit string:", err)
|
||||
}
|
||||
enc := xml.NewEncoder(j.out)
|
||||
enc.Indent("", s(2))
|
||||
if err := enc.Encode(j.suite); err != nil {
|
||||
if err = enc.Encode(j.suite); err != nil {
|
||||
fmt.Fprintln(os.Stderr, "failed to write junit xml:", err)
|
||||
}
|
||||
}
|
||||
|
|
|
@ -152,19 +152,18 @@ func TestJUnitFormatterOutput(t *testing.T) {
|
|||
},
|
||||
}},
|
||||
}
|
||||
|
||||
s.run()
|
||||
s.fmt.Summary()
|
||||
|
||||
var exp bytes.Buffer
|
||||
io.WriteString(&exp, xml.Header)
|
||||
|
||||
enc := xml.NewEncoder(&exp)
|
||||
enc.Indent("", " ")
|
||||
if err := enc.Encode(expected); err != nil {
|
||||
if _, err = io.WriteString(&exp, xml.Header); err != nil {
|
||||
t.Fatalf("unexpected error: %v", err)
|
||||
}
|
||||
enc := xml.NewEncoder(&exp)
|
||||
enc.Indent("", " ")
|
||||
if err = enc.Encode(expected); err != nil {
|
||||
t.Fatalf("unexpected error: %v", err)
|
||||
}
|
||||
|
||||
if buf.String() != exp.String() {
|
||||
t.Fatalf("expected output does not match: %s", buf.String())
|
||||
}
|
||||
|
|
|
@ -47,7 +47,7 @@ func (f *progress) Feature(ft *gherkin.Feature, p string, c []byte) {
|
|||
func (f *progress) Summary() {
|
||||
left := math.Mod(float64(f.steps), float64(f.stepsPerRow))
|
||||
if left != 0 {
|
||||
if int(f.steps) > f.stepsPerRow {
|
||||
if f.steps > f.stepsPerRow {
|
||||
fmt.Fprintf(f.out, s(f.stepsPerRow-int(left))+fmt.Sprintf(" %d\n", f.steps))
|
||||
} else {
|
||||
fmt.Fprintf(f.out, " %d\n", f.steps)
|
||||
|
|
|
@ -178,8 +178,8 @@ func TestFailsWithUnknownFormatterOptionError(t *testing.T) {
|
|||
}
|
||||
|
||||
out := strings.TrimSpace(string(b))
|
||||
if strings.Index(out, `unregistered formatter name: "unknown", use one of`) == -1 {
|
||||
t.Fatalf("unexpected error output: \"%s\"", out)
|
||||
if !strings.Contains(out, `unregistered formatter name: "unknown", use one of`) {
|
||||
t.Fatalf("unexpected error output: %q", out)
|
||||
}
|
||||
}
|
||||
|
||||
|
|
8
suite.go
8
suite.go
|
@ -402,12 +402,6 @@ func (s *Suite) runSteps(steps []*gherkin.Step) (err error) {
|
|||
return
|
||||
}
|
||||
|
||||
func (s *Suite) skipSteps(steps []*gherkin.Step) {
|
||||
for _, step := range steps {
|
||||
s.fmt.Skipped(step, s.matchStep(step))
|
||||
}
|
||||
}
|
||||
|
||||
func (s *Suite) runOutline(outline *gherkin.ScenarioOutline, b *gherkin.Background) (failErr error) {
|
||||
s.fmt.Node(outline)
|
||||
|
||||
|
@ -811,7 +805,7 @@ func matchesTags(filter string, tags []string) (ok bool) {
|
|||
okComma = hasTag(tags, tag) || okComma
|
||||
}
|
||||
}
|
||||
ok = (false != okComma && ok && okComma) || false
|
||||
ok = ok && okComma
|
||||
}
|
||||
return
|
||||
}
|
||||
|
|
22
utils.go
22
utils.go
|
@ -7,18 +7,16 @@ import (
|
|||
"github.com/DATA-DOG/godog/colors"
|
||||
)
|
||||
|
||||
// empty struct value takes no space allocation
|
||||
type void struct{}
|
||||
|
||||
var red = colors.Red
|
||||
var redb = colors.Bold(colors.Red)
|
||||
var green = colors.Green
|
||||
var black = colors.Black
|
||||
var blackb = colors.Bold(colors.Black)
|
||||
var yellow = colors.Yellow
|
||||
var cyan = colors.Cyan
|
||||
var cyanb = colors.Bold(colors.Cyan)
|
||||
var whiteb = colors.Bold(colors.White)
|
||||
var (
|
||||
red = colors.Red
|
||||
redb = colors.Bold(colors.Red)
|
||||
green = colors.Green
|
||||
black = colors.Black
|
||||
yellow = colors.Yellow
|
||||
cyan = colors.Cyan
|
||||
cyanb = colors.Bold(colors.Cyan)
|
||||
whiteb = colors.Bold(colors.White)
|
||||
)
|
||||
|
||||
// repeats a space n times
|
||||
func s(n int) string {
|
||||
|
|
Загрузка…
Создание таблицы
Сослаться в новой задаче