godog/internal/formatters/fmt.go
John Lonergan bcf6bce793
ambiguous step def detection akin to cucumber jvm (#636)
* added basic detection for ambiguous steps, but causes an error and not yet recorded in the reports as 'Ambiguous', and no test cases figured out yet

* added initial support for detection of ambiguous steps - further work take a look at how cuke jvm report ambiguous steps and sets the step status to 'ambiguous' rather than my current solution which just blows the test up as a regular step error

* added suite_context_test and also introduced missing 'ambiguous' status to make cucumber jvm'

* update CHANGELOG for ambiguous step defs

* missed file from commit

* added internal/formatters/fmt_multi_test.go

* add tests for other peoples code

* added "ambigous" to the help text

* tests

* added some more tests for attachments

* Update internal/flags/flags.go

Co-authored-by: Viacheslav Poturaev <nanopeni@gmail.com>

---------

Co-authored-by: Viacheslav Poturaev <nanopeni@gmail.com>
2024-07-01 10:28:39 +01:00

106 строки
2,7 КиБ
Go

package formatters
import (
"fmt"
"os"
"path/filepath"
"regexp"
"runtime"
"strconv"
"strings"
messages "github.com/cucumber/messages/go/v21"
"github.com/cucumber/godog/colors"
"github.com/cucumber/godog/internal/models"
"github.com/cucumber/godog/internal/utils"
)
var (
red = colors.Red
redb = colors.Bold(colors.Red)
green = colors.Green
blackb = colors.Bold(colors.Black)
yellow = colors.Yellow
cyan = colors.Cyan
cyanb = colors.Bold(colors.Cyan)
whiteb = colors.Bold(colors.White)
)
// repeats a space n times
var s = utils.S
var (
passed = models.Passed
failed = models.Failed
skipped = models.Skipped
undefined = models.Undefined
pending = models.Pending
ambiguous = models.Skipped
)
type sortFeaturesByName []*models.Feature
func (s sortFeaturesByName) Len() int { return len(s) }
func (s sortFeaturesByName) Less(i, j int) bool { return s[i].Feature.Name < s[j].Feature.Name }
func (s sortFeaturesByName) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
type sortPicklesByID []*messages.Pickle
func (s sortPicklesByID) Len() int { return len(s) }
func (s sortPicklesByID) Less(i, j int) bool {
iID := mustConvertStringToInt(s[i].Id)
jID := mustConvertStringToInt(s[j].Id)
return iID < jID
}
func (s sortPicklesByID) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
type sortPickleStepResultsByPickleStepID []models.PickleStepResult
func (s sortPickleStepResultsByPickleStepID) Len() int { return len(s) }
func (s sortPickleStepResultsByPickleStepID) Less(i, j int) bool {
iID := mustConvertStringToInt(s[i].PickleStepID)
jID := mustConvertStringToInt(s[j].PickleStepID)
return iID < jID
}
func (s sortPickleStepResultsByPickleStepID) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
func mustConvertStringToInt(s string) int {
i, err := strconv.Atoi(s)
if err != nil {
panic(err)
}
return i
}
// DefinitionID ...
func DefinitionID(sd *models.StepDefinition) string {
ptr := sd.HandlerValue.Pointer()
f := runtime.FuncForPC(ptr)
file, line := f.FileLine(ptr)
dir := filepath.Dir(file)
fn := strings.Replace(f.Name(), dir, "", -1)
var parts []string
for _, gr := range matchFuncDefRef.FindAllStringSubmatch(fn, -1) {
parts = append(parts, strings.Trim(gr[1], "_."))
}
if len(parts) > 0 {
// case when suite is a structure with methods
fn = strings.Join(parts, ".")
} else {
// case when steps are just plain funcs
fn = strings.Trim(fn, "_.")
}
if pkg := os.Getenv("GODOG_TESTED_PACKAGE"); len(pkg) > 0 {
fn = strings.Replace(fn, pkg, "", 1)
fn = strings.TrimLeft(fn, ".")
fn = strings.Replace(fn, "..", ".", -1)
}
return fmt.Sprintf("%s:%d -> %s", filepath.Base(file), line, fn)
}
var matchFuncDefRef = regexp.MustCompile(`\(([^\)]+)\)`)