update messages-go to v16.0.1 bump gomod version comment on log line in std os.Stderr examples to non rc version go mod tidy update circle (tbd)
105 строки
2,6 КиБ
Go
105 строки
2,6 КиБ
Go
package formatters
|
|
|
|
import (
|
|
"fmt"
|
|
"os"
|
|
"path/filepath"
|
|
"regexp"
|
|
"runtime"
|
|
"strconv"
|
|
"strings"
|
|
|
|
"github.com/cucumber/messages-go/v16"
|
|
|
|
"github.com/cucumber/godog/colors"
|
|
"github.com/cucumber/godog/internal/models"
|
|
"github.com/cucumber/godog/internal/utils"
|
|
)
|
|
|
|
var (
|
|
red = colors.Red
|
|
redb = colors.Bold(colors.Red)
|
|
green = colors.Green
|
|
blackb = colors.Bold(colors.Black)
|
|
yellow = colors.Yellow
|
|
cyan = colors.Cyan
|
|
cyanb = colors.Bold(colors.Cyan)
|
|
whiteb = colors.Bold(colors.White)
|
|
)
|
|
|
|
// repeats a space n times
|
|
var s = utils.S
|
|
|
|
var (
|
|
passed = models.Passed
|
|
failed = models.Failed
|
|
skipped = models.Skipped
|
|
undefined = models.Undefined
|
|
pending = models.Pending
|
|
)
|
|
|
|
type sortFeaturesByName []*models.Feature
|
|
|
|
func (s sortFeaturesByName) Len() int { return len(s) }
|
|
func (s sortFeaturesByName) Less(i, j int) bool { return s[i].Feature.Name < s[j].Feature.Name }
|
|
func (s sortFeaturesByName) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
|
|
|
|
type sortPicklesByID []*messages.Pickle
|
|
|
|
func (s sortPicklesByID) Len() int { return len(s) }
|
|
func (s sortPicklesByID) Less(i, j int) bool {
|
|
iID := mustConvertStringToInt(s[i].Id)
|
|
jID := mustConvertStringToInt(s[j].Id)
|
|
return iID < jID
|
|
}
|
|
func (s sortPicklesByID) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
|
|
|
|
type sortPickleStepResultsByPickleStepID []models.PickleStepResult
|
|
|
|
func (s sortPickleStepResultsByPickleStepID) Len() int { return len(s) }
|
|
func (s sortPickleStepResultsByPickleStepID) Less(i, j int) bool {
|
|
iID := mustConvertStringToInt(s[i].PickleStepID)
|
|
jID := mustConvertStringToInt(s[j].PickleStepID)
|
|
return iID < jID
|
|
}
|
|
func (s sortPickleStepResultsByPickleStepID) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
|
|
|
|
func mustConvertStringToInt(s string) int {
|
|
i, err := strconv.Atoi(s)
|
|
if err != nil {
|
|
panic(err)
|
|
}
|
|
|
|
return i
|
|
}
|
|
|
|
// DefinitionID ...
|
|
func DefinitionID(sd *models.StepDefinition) string {
|
|
ptr := sd.HandlerValue.Pointer()
|
|
f := runtime.FuncForPC(ptr)
|
|
file, line := f.FileLine(ptr)
|
|
dir := filepath.Dir(file)
|
|
|
|
fn := strings.Replace(f.Name(), dir, "", -1)
|
|
var parts []string
|
|
for _, gr := range matchFuncDefRef.FindAllStringSubmatch(fn, -1) {
|
|
parts = append(parts, strings.Trim(gr[1], "_."))
|
|
}
|
|
if len(parts) > 0 {
|
|
// case when suite is a structure with methods
|
|
fn = strings.Join(parts, ".")
|
|
} else {
|
|
// case when steps are just plain funcs
|
|
fn = strings.Trim(fn, "_.")
|
|
}
|
|
|
|
if pkg := os.Getenv("GODOG_TESTED_PACKAGE"); len(pkg) > 0 {
|
|
fn = strings.Replace(fn, pkg, "", 1)
|
|
fn = strings.TrimLeft(fn, ".")
|
|
fn = strings.Replace(fn, "..", ".", -1)
|
|
}
|
|
|
|
return fmt.Sprintf("%s:%d -> %s", filepath.Base(file), line, fn)
|
|
}
|
|
|
|
var matchFuncDefRef = regexp.MustCompile(`\(([^\)]+)\)`)
|